C9H13N3OS2 — CID 130484221
1,4-dithian-2-yl-(3-ethyltriazol-4-yl)methanone (PubChem CID 130484221) has the molecular formula C9H13N3OS2 and a molecular weight of 243.36 g/mol. Its IUPAC name is 1,4-dithian-2-yl-(3-ethyltriazol-4-yl)methanone.
| Compound Name | 1,4-dithian-2-yl-(3-ethyltriazol-4-yl)methanone |
|---|---|
| PubChem CID | 130484221 |
| Molecular Formula | C9H13N3OS2 |
| Molecular Weight | 243.36 g/mol |
| Exact Mass | 243.05 |
| IUPAC Name | 1,4-dithian-2-yl-(3-ethyltriazol-4-yl)methanone |
| SMILES | CCn1nncc1C(=O)C1CSCCS1 |
| InChI | InChI=1S/C9H13N3OS2/c1-2-12-7(5-10-11-12)9(13)8-6-14-3-4-15-8/h5,8H,2-4,6H2,1H3 |
| InChIKey | UFOYBAODUFRPQL-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.36 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |