C10H14F2OS — CID 130487358
4-[(3,3-difluorocyclopentyl)methyl]thiolan-3-one (PubChem CID 130487358) has the molecular formula C10H14F2OS and a molecular weight of 220.28 g/mol. Its IUPAC name is 4-[(3,3-difluorocyclopentyl)methyl]thiolan-3-one.
| Compound Name | 4-[(3,3-difluorocyclopentyl)methyl]thiolan-3-one |
|---|---|
| PubChem CID | 130487358 |
| Molecular Formula | C10H14F2OS |
| Molecular Weight | 220.28 g/mol |
| Exact Mass | 220.07 |
| IUPAC Name | 4-[(3,3-difluorocyclopentyl)methyl]thiolan-3-one |
| SMILES | O=C1CSCC1CC1CCC(F)(F)C1 |
| InChI | InChI=1S/C10H14F2OS/c11-10(12)2-1-7(4-10)3-8-5-14-6-9(8)13/h7-8H,1-6H2 |
| InChIKey | FOUXQBZMWXNXCO-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.28 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |