C18H17N — CID 13049760
N,N-dimethyltetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13,15-heptaen-1-amine (PubChem CID 13049760) has the molecular formula C18H17N and a molecular weight of 247.34 g/mol. Its IUPAC name is N,N-dimethyltetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13,15-heptaen-1-amine.
| Compound Name | N,N-dimethyltetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13,15-heptaen-1-amine |
|---|---|
| PubChem CID | 13049760 |
| Molecular Formula | C18H17N |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.14 |
| IUPAC Name | N,N-dimethyltetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13,15-heptaen-1-amine |
| SMILES | CN(C)C12C=CC(c3ccccc31)c1ccccc12 |
| InChI | InChI=1S/C18H17N/c1-19(2)18-12-11-13(14-7-3-5-9-16(14)18)15-8-4-6-10-17(15)18/h3-13H,1-2H3 |
| InChIKey | RFEBOVJFIAZQFP-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|