C9H3Br3IN — CID 130499412
3,4,5-tribromo-8-iodoquinoline (PubChem CID 130499412) has the molecular formula C9H3Br3IN and a molecular weight of 491.75 g/mol. Its IUPAC name is 3,4,5-tribromo-8-iodoquinoline.
| Compound Name | 3,4,5-tribromo-8-iodoquinoline |
|---|---|
| PubChem CID | 130499412 |
| Molecular Formula | C9H3Br3IN |
| Molecular Weight | 491.75 g/mol |
| Exact Mass | 488.69 |
| IUPAC Name | 3,4,5-tribromo-8-iodoquinoline |
| SMILES | Brc1cnc2c(I)ccc(Br)c2c1Br |
| InChI | InChI=1S/C9H3Br3IN/c10-4-1-2-6(13)9-7(4)8(12)5(11)3-14-9/h1-3H |
| InChIKey | ZWQVYQDXFUVTDI-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.75 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|