C21H19F6N3O2 — CID 13050574
2-[4,5-bis(4-methoxyphenyl)-1-methylimidazol-2-yl]-1,1,1,3,3,3-hexafluoropropan-2-amine (PubChem CID 13050574) has the molecular formula C21H19F6N3O2 and a molecular weight of 459.39 g/mol. Its IUPAC name is 2-[4,5-bis(4-methoxyphenyl)-1-methylimidazol-2-yl]-1,1,1,3,3,3-hexafluoropropan-2-amine.
| Compound Name | 2-[4,5-bis(4-methoxyphenyl)-1-methylimidazol-2-yl]-1,1,1,3,3,3-hexafluoropropan-2-amine |
|---|---|
| PubChem CID | 13050574 |
| Molecular Formula | C21H19F6N3O2 |
| Molecular Weight | 459.39 g/mol |
| Exact Mass | 459.14 |
| IUPAC Name | 2-[4,5-bis(4-methoxyphenyl)-1-methylimidazol-2-yl]-1,1,1,3,3,3-hexafluoropropan-2-amine |
| SMILES | COc1ccc(-c2nc(C(N)(C(F)(F)F)C(F)(F)F)n(C)c2-c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C21H19F6N3O2/c1-30-17(13-6-10-15(32-3)11-7-13)16(12-4-8-14(31-2)9-5-12)29-18(30)19(28,20(22,23)24)21(25,26)27/h4-11H,28H2,1-3H3 |
| InChIKey | QWBBNANFPISGNR-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.39 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |