C11H11BrFN — CID 130506757
5-(3-bromo-2-fluorophenyl)-1,2,3,6-tetrahydropyridine (PubChem CID 130506757) has the molecular formula C11H11BrFN and a molecular weight of 256.12 g/mol. Its IUPAC name is 5-(3-bromo-2-fluorophenyl)-1,2,3,6-tetrahydropyridine.
| Compound Name | 5-(3-bromo-2-fluorophenyl)-1,2,3,6-tetrahydropyridine |
|---|---|
| PubChem CID | 130506757 |
| Molecular Formula | C11H11BrFN |
| Molecular Weight | 256.12 g/mol |
| Exact Mass | 255.01 |
| IUPAC Name | 5-(3-bromo-2-fluorophenyl)-1,2,3,6-tetrahydropyridine |
| SMILES | Fc1c(Br)cccc1C1=CCCNC1 |
| InChI | InChI=1S/C11H11BrFN/c12-10-5-1-4-9(11(10)13)8-3-2-6-14-7-8/h1,3-5,14H,2,6-7H2 |
| InChIKey | DRJKFWFZZQDECD-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.12 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |