C28H30N4O4 — CID 3068362
oxalic acid;bis(4-(1,2,3,6-tetrahydropyridin-5-yl)-1H-indole) (PubChem CID 3068362) has the molecular formula C28H30N4O4 and a molecular weight of 486.57 g/mol. Its IUPAC name is oxalic acid;bis(4-(1,2,3,6-tetrahydropyridin-5-yl)-1H-indole).
| Compound Name | oxalic acid;bis(4-(1,2,3,6-tetrahydropyridin-5-yl)-1H-indole) |
|---|---|
| PubChem CID | 3068362 |
| Molecular Formula | C28H30N4O4 |
| Molecular Weight | 486.57 g/mol |
| Exact Mass | 486.23 |
| IUPAC Name | oxalic acid;bis(4-(1,2,3,6-tetrahydropyridin-5-yl)-1H-indole) |
| SMILES | C1=C(c2cccc3[nH]ccc23)CNCC1.C1=C(c2cccc3[nH]ccc23)CNCC1.O=C(O)C(=O)O |
| InChI | InChI=1S/2C13H14N2.C2H2O4/c2*1-4-11(10-3-2-7-14-9-10)12-6-8-15-13(12)5-1;3-1(4)2(5)6/h2*1,3-6,8,14-15H,2,7,9H2;(H,3,4)(H,5,6) |
| InChIKey | YEUJTSSECIZFCS-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 130.24 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.57 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|