C10H11FN2 — CID 130506741
3-fluoro-4-(1,2,3,6-tetrahydropyridin-5-yl)pyridine (PubChem CID 130506741) has the molecular formula C10H11FN2 and a molecular weight of 178.21 g/mol. Its IUPAC name is 3-fluoro-4-(1,2,3,6-tetrahydropyridin-5-yl)pyridine.
| Compound Name | 3-fluoro-4-(1,2,3,6-tetrahydropyridin-5-yl)pyridine |
|---|---|
| PubChem CID | 130506741 |
| Molecular Formula | C10H11FN2 |
| Molecular Weight | 178.21 g/mol |
| Exact Mass | 178.09 |
| IUPAC Name | 3-fluoro-4-(1,2,3,6-tetrahydropyridin-5-yl)pyridine |
| SMILES | Fc1cnccc1C1=CCCNC1 |
| InChI | InChI=1S/C10H11FN2/c11-10-7-13-5-3-9(10)8-2-1-4-12-6-8/h2-3,5,7,12H,1,4,6H2 |
| InChIKey | OHHSQWLWTCUKHK-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.21 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |