C9H12I2N2O — CID 130508537
1-(4,5-diiodoimidazol-1-yl)-3,3-dimethylbutan-2-one (PubChem CID 130508537) has the molecular formula C9H12I2N2O and a molecular weight of 418.02 g/mol. Its IUPAC name is 1-(4,5-diiodoimidazol-1-yl)-3,3-dimethylbutan-2-one.
| Compound Name | 1-(4,5-diiodoimidazol-1-yl)-3,3-dimethylbutan-2-one |
|---|---|
| PubChem CID | 130508537 |
| Molecular Formula | C9H12I2N2O |
| Molecular Weight | 418.02 g/mol |
| Exact Mass | 417.90 |
| IUPAC Name | 1-(4,5-diiodoimidazol-1-yl)-3,3-dimethylbutan-2-one |
| SMILES | CC(C)(C)C(=O)Cn1cnc(I)c1I |
| InChI | InChI=1S/C9H12I2N2O/c1-9(2,3)6(14)4-13-5-12-7(10)8(13)11/h5H,4H2,1-3H3 |
| InChIKey | DQHDZVYSPSKGOM-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.02 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|