C11H13NO2 — CID 130510016
(3,4-dimethyl-1H-pyrrol-2-yl)-(furan-2-yl)methanol (PubChem CID 130510016) has the molecular formula C11H13NO2 and a molecular weight of 191.23 g/mol. Its IUPAC name is (3,4-dimethyl-1H-pyrrol-2-yl)-(furan-2-yl)methanol.
| Compound Name | (3,4-dimethyl-1H-pyrrol-2-yl)-(furan-2-yl)methanol |
|---|---|
| PubChem CID | 130510016 |
| Molecular Formula | C11H13NO2 |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.09 |
| IUPAC Name | (3,4-dimethyl-1H-pyrrol-2-yl)-(furan-2-yl)methanol |
| SMILES | Cc1c[nH]c(C(O)c2ccco2)c1C |
| InChI | InChI=1S/C11H13NO2/c1-7-6-12-10(8(7)2)11(13)9-4-3-5-14-9/h3-6,11-13H,1-2H3 |
| InChIKey | YATJPIOTUWABPY-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 49.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |