C12H15NO2 — CID 63927710
furan-2-yl-(3,4,5-trimethyl-1H-pyrrol-2-yl)methanol (PubChem CID 63927710) has the molecular formula C12H15NO2 and a molecular weight of 205.26 g/mol. Its IUPAC name is furan-2-yl-(3,4,5-trimethyl-1H-pyrrol-2-yl)methanol.
| Compound Name | furan-2-yl-(3,4,5-trimethyl-1H-pyrrol-2-yl)methanol |
|---|---|
| PubChem CID | 63927710 |
| Molecular Formula | C12H15NO2 |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | furan-2-yl-(3,4,5-trimethyl-1H-pyrrol-2-yl)methanol |
| SMILES | Cc1[nH]c(C(O)c2ccco2)c(C)c1C |
| InChI | InChI=1S/C12H15NO2/c1-7-8(2)11(13-9(7)3)12(14)10-5-4-6-15-10/h4-6,12-14H,1-3H3 |
| InChIKey | ONIUEMVNWHGVSX-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 49.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |