C12H21N — CID 130510766
2-(3,4-dimethylcyclohexyl)-2,5-dihydro-1H-pyrrole (PubChem CID 130510766) has the molecular formula C12H21N and a molecular weight of 179.31 g/mol. Its IUPAC name is 2-(3,4-dimethylcyclohexyl)-2,5-dihydro-1H-pyrrole.
| Compound Name | 2-(3,4-dimethylcyclohexyl)-2,5-dihydro-1H-pyrrole |
|---|---|
| PubChem CID | 130510766 |
| Molecular Formula | C12H21N |
| Molecular Weight | 179.31 g/mol |
| Exact Mass | 179.17 |
| IUPAC Name | 2-(3,4-dimethylcyclohexyl)-2,5-dihydro-1H-pyrrole |
| SMILES | CC1CCC(C2C=CCN2)CC1C |
| InChI | InChI=1S/C12H21N/c1-9-5-6-11(8-10(9)2)12-4-3-7-13-12/h3-4,9-13H,5-8H2,1-2H3 |
| InChIKey | LFHTUIFZBSLVHT-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.31 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|