C13H26N2 — CID 144846797
4-(3,4-dimethylcyclohexyl)pyrazolidine;ethene (PubChem CID 144846797) has the molecular formula C13H26N2 and a molecular weight of 210.36 g/mol. Its IUPAC name is 4-(3,4-dimethylcyclohexyl)pyrazolidine;ethene.
| Compound Name | 4-(3,4-dimethylcyclohexyl)pyrazolidine;ethene |
|---|---|
| PubChem CID | 144846797 |
| Molecular Formula | C13H26N2 |
| Molecular Weight | 210.36 g/mol |
| Exact Mass | 210.21 |
| IUPAC Name | 4-(3,4-dimethylcyclohexyl)pyrazolidine;ethene |
| SMILES | C=C.CC1CCC(C2CNNC2)CC1C |
| InChI | InChI=1S/C11H22N2.C2H4/c1-8-3-4-10(5-9(8)2)11-6-12-13-7-11;1-2/h8-13H,3-7H2,1-2H3;1-2H2 |
| InChIKey | HYRZBLIJSXHPHB-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.36 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|