C9H10BrNO2S2 — CID 130524716
2-(5-bromothiophen-3-yl)-1,3-thiazinane-4-carboxylic acid (PubChem CID 130524716) has the molecular formula C9H10BrNO2S2 and a molecular weight of 308.22 g/mol. Its IUPAC name is 2-(5-bromothiophen-3-yl)-1,3-thiazinane-4-carboxylic acid.
| Compound Name | 2-(5-bromothiophen-3-yl)-1,3-thiazinane-4-carboxylic acid |
|---|---|
| PubChem CID | 130524716 |
| Molecular Formula | C9H10BrNO2S2 |
| Molecular Weight | 308.22 g/mol |
| Exact Mass | 306.93 |
| IUPAC Name | 2-(5-bromothiophen-3-yl)-1,3-thiazinane-4-carboxylic acid |
| SMILES | O=C(O)C1CCSC(c2csc(Br)c2)N1 |
| InChI | InChI=1S/C9H10BrNO2S2/c10-7-3-5(4-15-7)8-11-6(9(12)13)1-2-14-8/h3-4,6,8,11H,1-2H2,(H,12,13) |
| InChIKey | JXYPOPPKKWCXQB-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.22 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |