C8H15N3O — CID 130529355
3-methyl-1-(2-methyl-1,2,4-triazol-3-yl)butan-1-ol (PubChem CID 130529355) has the molecular formula C8H15N3O and a molecular weight of 169.23 g/mol. Its IUPAC name is 3-methyl-1-(2-methyl-1,2,4-triazol-3-yl)butan-1-ol.
| Compound Name | 3-methyl-1-(2-methyl-1,2,4-triazol-3-yl)butan-1-ol |
|---|---|
| PubChem CID | 130529355 |
| Molecular Formula | C8H15N3O |
| Molecular Weight | 169.23 g/mol |
| Exact Mass | 169.12 |
| IUPAC Name | 3-methyl-1-(2-methyl-1,2,4-triazol-3-yl)butan-1-ol |
| SMILES | CC(C)CC(O)c1ncnn1C |
| InChI | InChI=1S/C8H15N3O/c1-6(2)4-7(12)8-9-5-10-11(8)3/h5-7,12H,4H2,1-3H3 |
| InChIKey | OROOMMJXLRWSSF-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.23 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |