About 3-[(4-amino-1,3,5-triazin-2-yl)-methylamino]-2-methylpropanenitrile
3-[(4-amino-1,3,5-triazin-2-yl)-methylamino]-2-methylpropanenitrile (PubChem CID 130532582) has the molecular formula C8H12N6
and a molecular weight of 192.23 g/mol. Its IUPAC name is 3-[(4-amino-1,3,5-triazin-2-yl)-methylamino]-2-methylpropanenitrile.
Molecular Properties
| Compound Name | 3-[(4-amino-1,3,5-triazin-2-yl)-methylamino]-2-methylpropanenitrile |
| PubChem CID | 130532582 |
| Molecular Formula | C8H12N6 |
| Molecular Weight | 192.23 g/mol |
| Exact Mass | 192.11 |
| IUPAC Name | 3-[(4-amino-1,3,5-triazin-2-yl)-methylamino]-2-methylpropanenitrile |
| SMILES | CC(C#N)CN(C)c1ncnc(N)n1 |
| InChI | InChI=1S/C8H12N6/c1-6(3-9)4-14(2)8-12-5-11-7(10)13-8/h5-6H,4H2,1-2H3,(H2,10,11,12,13) |
| InChIKey | CLVIZVKBIZHZSB-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 91.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.23 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-[(4-amino-1,3,5-triazin-2-yl)-methylamino]-2-methylpropanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(4-amino-1,3,5-triazin-2-yl)-methylamino]-2-methylpropanenitrile?
The IUPAC name of 3-[(4-amino-1,3,5-triazin-2-yl)-methylamino]-2-methylpropanenitrile (CID 130532582) is 3-[(4-amino-1,3,5-triazin-2-yl)-methylamino]-2-methylpropanenitrile.
What is the SMILES notation for 3-[(4-amino-1,3,5-triazin-2-yl)-methylamino]-2-methylpropanenitrile?
The canonical SMILES for 3-[(4-amino-1,3,5-triazin-2-yl)-methylamino]-2-methylpropanenitrile is CC(C#N)CN(C)c1ncnc(N)n1.
What is the InChIKey of 3-[(4-amino-1,3,5-triazin-2-yl)-methylamino]-2-methylpropanenitrile?
The InChIKey is CLVIZVKBIZHZSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N6/c1-6(3-9)4-14(2)8-12-5-11-7(10)13-8/h5-6H,4H2,1-2H3,(H2,10,11,12,13).
What are the key properties of 3-[(4-amino-1,3,5-triazin-2-yl)-methylamino]-2-methylpropanenitrile?
3-[(4-amino-1,3,5-triazin-2-yl)-methylamino]-2-methylpropanenitrile has a molecular weight of 192.23 g/mol, XLogP of 0.05, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(4-amino-1,3,5-triazin-2-yl)-methylamino]-2-methylpropanenitrile is sourced from PubChem (CID 130532582), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).