About 2-bromo-5-chloro-N-(2,2-dimethylpropyl)pyridin-3-amine
2-bromo-5-chloro-N-(2,2-dimethylpropyl)pyridin-3-amine (PubChem CID 130535397) has the molecular formula C10H14BrClN2
and a molecular weight of 277.59 g/mol. Its IUPAC name is 2-bromo-5-chloro-N-(2,2-dimethylpropyl)pyridin-3-amine.
Molecular Properties
| Compound Name | 2-bromo-5-chloro-N-(2,2-dimethylpropyl)pyridin-3-amine |
| PubChem CID | 130535397 |
| Molecular Formula | C10H14BrClN2 |
| Molecular Weight | 277.59 g/mol |
| Exact Mass | 276.00 |
| IUPAC Name | 2-bromo-5-chloro-N-(2,2-dimethylpropyl)pyridin-3-amine |
| SMILES | CC(C)(C)CNc1cc(Cl)cnc1Br |
| InChI | InChI=1S/C10H14BrClN2/c1-10(2,3)6-14-8-4-7(12)5-13-9(8)11/h4-5,14H,6H2,1-3H3 |
| InChIKey | OATNQJYPJVPASR-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.59 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-5-chloro-N-(2,2-dimethylpropyl)pyridin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-5-chloro-N-(2,2-dimethylpropyl)pyridin-3-amine?
The IUPAC name of 2-bromo-5-chloro-N-(2,2-dimethylpropyl)pyridin-3-amine (CID 130535397) is 2-bromo-5-chloro-N-(2,2-dimethylpropyl)pyridin-3-amine.
What is the SMILES notation for 2-bromo-5-chloro-N-(2,2-dimethylpropyl)pyridin-3-amine?
The canonical SMILES for 2-bromo-5-chloro-N-(2,2-dimethylpropyl)pyridin-3-amine is CC(C)(C)CNc1cc(Cl)cnc1Br.
What is the InChIKey of 2-bromo-5-chloro-N-(2,2-dimethylpropyl)pyridin-3-amine?
The InChIKey is OATNQJYPJVPASR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14BrClN2/c1-10(2,3)6-14-8-4-7(12)5-13-9(8)11/h4-5,14H,6H2,1-3H3.
What are the key properties of 2-bromo-5-chloro-N-(2,2-dimethylpropyl)pyridin-3-amine?
2-bromo-5-chloro-N-(2,2-dimethylpropyl)pyridin-3-amine has a molecular weight of 277.59 g/mol, XLogP of 3.96, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-5-chloro-N-(2,2-dimethylpropyl)pyridin-3-amine is sourced from PubChem (CID 130535397), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).