C7H10N6S — CID 130549061
3-(1-propan-2-yltriazol-4-yl)-1,2,4-thiadiazol-5-amine (PubChem CID 130549061) has the molecular formula C7H10N6S and a molecular weight of 210.27 g/mol. Its IUPAC name is 3-(1-propan-2-yltriazol-4-yl)-1,2,4-thiadiazol-5-amine.
| Compound Name | 3-(1-propan-2-yltriazol-4-yl)-1,2,4-thiadiazol-5-amine |
|---|---|
| PubChem CID | 130549061 |
| Molecular Formula | C7H10N6S |
| Molecular Weight | 210.27 g/mol |
| Exact Mass | 210.07 |
| IUPAC Name | 3-(1-propan-2-yltriazol-4-yl)-1,2,4-thiadiazol-5-amine |
| SMILES | CC(C)n1cc(-c2nsc(N)n2)nn1 |
| InChI | InChI=1S/C7H10N6S/c1-4(2)13-3-5(10-12-13)6-9-7(8)14-11-6/h3-4H,1-2H3,(H2,8,9,11) |
| InChIKey | LWVANRSFHQQDPY-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 82.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.27 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |