C10H14N4S — CID 143818137
ethane;3-(5-methyl-2-pyridinyl)-1,2,4-thiadiazol-5-amine (PubChem CID 143818137) has the molecular formula C10H14N4S and a molecular weight of 222.32 g/mol. Its IUPAC name is ethane;3-(5-methyl-2-pyridinyl)-1,2,4-thiadiazol-5-amine.
| Compound Name | ethane;3-(5-methyl-2-pyridinyl)-1,2,4-thiadiazol-5-amine |
|---|---|
| PubChem CID | 143818137 |
| Molecular Formula | C10H14N4S |
| Molecular Weight | 222.32 g/mol |
| Exact Mass | 222.09 |
| IUPAC Name | ethane;3-(5-methyl-2-pyridinyl)-1,2,4-thiadiazol-5-amine |
| SMILES | CC.Cc1ccc(-c2nsc(N)n2)nc1 |
| InChI | InChI=1S/C8H8N4S.C2H6/c1-5-2-3-6(10-4-5)7-11-8(9)13-12-7;1-2/h2-4H,1H3,(H2,9,11,12);1-2H3 |
| InChIKey | AFRIMHUPVLNFDV-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.32 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |