C18H16N2S — CID 130556969
N-benzyl-7-methyl-4H-indeno[1,2-d][1,3]thiazol-2-amine (PubChem CID 130556969) has the molecular formula C18H16N2S and a molecular weight of 292.41 g/mol. Its IUPAC name is N-benzyl-7-methyl-4H-indeno[1,2-d][1,3]thiazol-2-amine.
| Compound Name | N-benzyl-7-methyl-4H-indeno[1,2-d][1,3]thiazol-2-amine |
|---|---|
| PubChem CID | 130556969 |
| Molecular Formula | C18H16N2S |
| Molecular Weight | 292.41 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | N-benzyl-7-methyl-4H-indeno[1,2-d][1,3]thiazol-2-amine |
| SMILES | Cc1ccc2c(c1)-c1nc(NCc3ccccc3)sc1C2 |
| InChI | InChI=1S/C18H16N2S/c1-12-7-8-14-10-16-17(15(14)9-12)20-18(21-16)19-11-13-5-3-2-4-6-13/h2-9H,10-11H2,1H3,(H,19,20) |
| InChIKey | RXHCPOMQXJKAEA-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.41 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |