C18H15IN2S — CID 11395976
6-(3,4-dimethylphenyl)-N-iodo-4H-indeno[1,2-d][1,3]thiazol-2-amine (PubChem CID 11395976) has the molecular formula C18H15IN2S and a molecular weight of 418.30 g/mol. Its IUPAC name is 6-(3,4-dimethylphenyl)-N-iodo-4H-indeno[1,2-d][1,3]thiazol-2-amine.
| Compound Name | 6-(3,4-dimethylphenyl)-N-iodo-4H-indeno[1,2-d][1,3]thiazol-2-amine |
|---|---|
| PubChem CID | 11395976 |
| Molecular Formula | C18H15IN2S |
| Molecular Weight | 418.30 g/mol |
| Exact Mass | 418.00 |
| IUPAC Name | 6-(3,4-dimethylphenyl)-N-iodo-4H-indeno[1,2-d][1,3]thiazol-2-amine |
| SMILES | Cc1ccc(-c2ccc3c(c2)Cc2sc(NI)nc2-3)cc1C |
| InChI | InChI=1S/C18H15IN2S/c1-10-3-4-12(7-11(10)2)13-5-6-15-14(8-13)9-16-17(15)20-18(21-19)22-16/h3-8H,9H2,1-2H3,(H,20,21) |
| InChIKey | DXEYDRJMXGDKBW-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.30 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|