C18H20N2O2S — CID 71625210
ethyl (E)-3-[2-(propylamino)-4H-indeno[1,2-d][1,3]thiazol-6-yl]prop-2-enoate (PubChem CID 71625210) has the molecular formula C18H20N2O2S and a molecular weight of 328.44 g/mol. Its IUPAC name is ethyl (E)-3-[2-(propylamino)-4H-indeno[1,2-d][1,3]thiazol-6-yl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[2-(propylamino)-4H-indeno[1,2-d][1,3]thiazol-6-yl]prop-2-enoate |
|---|---|
| PubChem CID | 71625210 |
| Molecular Formula | C18H20N2O2S |
| Molecular Weight | 328.44 g/mol |
| Exact Mass | 328.12 |
| IUPAC Name | ethyl (E)-3-[2-(propylamino)-4H-indeno[1,2-d][1,3]thiazol-6-yl]prop-2-enoate |
| SMILES | CCCNc1nc2c(s1)Cc1cc(/C=C/C(=O)OCC)ccc1-2 |
| InChI | InChI=1S/C18H20N2O2S/c1-3-9-19-18-20-17-14-7-5-12(6-8-16(21)22-4-2)10-13(14)11-15(17)23-18/h5-8,10H,3-4,9,11H2,1-2H3,(H,19,20)/b8-6+ |
| InChIKey | KJPONBWJZHPVOF-SOFGYWHQSA-N |
| XLogP | 4.11 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.44 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|