C10H16N2S — CID 130562612
(3-methyl-1-thiophen-3-ylpyrrolidin-3-yl)methanamine (PubChem CID 130562612) has the molecular formula C10H16N2S and a molecular weight of 196.32 g/mol. Its IUPAC name is (3-methyl-1-thiophen-3-ylpyrrolidin-3-yl)methanamine.
| Compound Name | (3-methyl-1-thiophen-3-ylpyrrolidin-3-yl)methanamine |
|---|---|
| PubChem CID | 130562612 |
| Molecular Formula | C10H16N2S |
| Molecular Weight | 196.32 g/mol |
| Exact Mass | 196.10 |
| IUPAC Name | (3-methyl-1-thiophen-3-ylpyrrolidin-3-yl)methanamine |
| SMILES | CC1(CN)CCN(c2ccsc2)C1 |
| InChI | InChI=1S/C10H16N2S/c1-10(7-11)3-4-12(8-10)9-2-5-13-6-9/h2,5-6H,3-4,7-8,11H2,1H3 |
| InChIKey | GHGNEGPIAYNNJN-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.32 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |