C7H8BrN5O — CID 130566535
3-[[5-(bromomethyl)triazol-1-yl]methyl]-5-methyl-1,2,4-oxadiazole (PubChem CID 130566535) has the molecular formula C7H8BrN5O and a molecular weight of 258.08 g/mol. Its IUPAC name is 3-[[5-(bromomethyl)triazol-1-yl]methyl]-5-methyl-1,2,4-oxadiazole.
| Compound Name | 3-[[5-(bromomethyl)triazol-1-yl]methyl]-5-methyl-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 130566535 |
| Molecular Formula | C7H8BrN5O |
| Molecular Weight | 258.08 g/mol |
| Exact Mass | 256.99 |
| IUPAC Name | 3-[[5-(bromomethyl)triazol-1-yl]methyl]-5-methyl-1,2,4-oxadiazole |
| SMILES | Cc1nc(Cn2nncc2CBr)no1 |
| InChI | InChI=1S/C7H8BrN5O/c1-5-10-7(11-14-5)4-13-6(2-8)3-9-12-13/h3H,2,4H2,1H3 |
| InChIKey | YCBCIAYRZZJMGK-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 69.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.08 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|