C8H11N5S — CID 130567402
1-[3-(1,3-thiazol-5-ylmethyl)triazol-4-yl]ethanamine (PubChem CID 130567402) has the molecular formula C8H11N5S and a molecular weight of 209.28 g/mol. Its IUPAC name is 1-[3-(1,3-thiazol-5-ylmethyl)triazol-4-yl]ethanamine.
| Compound Name | 1-[3-(1,3-thiazol-5-ylmethyl)triazol-4-yl]ethanamine |
|---|---|
| PubChem CID | 130567402 |
| Molecular Formula | C8H11N5S |
| Molecular Weight | 209.28 g/mol |
| Exact Mass | 209.07 |
| IUPAC Name | 1-[3-(1,3-thiazol-5-ylmethyl)triazol-4-yl]ethanamine |
| SMILES | CC(N)c1cnnn1Cc1cncs1 |
| InChI | InChI=1S/C8H11N5S/c1-6(9)8-3-11-12-13(8)4-7-2-10-5-14-7/h2-3,5-6H,4,9H2,1H3 |
| InChIKey | SXBVWZAGWOHWMK-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.28 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |