C5H5N5S — CID 91546748
5-(tetrazol-2-ylmethyl)-1,3-thiazole (PubChem CID 91546748) has the molecular formula C5H5N5S and a molecular weight of 167.20 g/mol. Its IUPAC name is 5-(tetrazol-2-ylmethyl)-1,3-thiazole.
| Compound Name | 5-(tetrazol-2-ylmethyl)-1,3-thiazole |
|---|---|
| PubChem CID | 91546748 |
| Molecular Formula | C5H5N5S |
| Molecular Weight | 167.20 g/mol |
| Exact Mass | 167.03 |
| IUPAC Name | 5-(tetrazol-2-ylmethyl)-1,3-thiazole |
| SMILES | c1nnn(Cc2cncs2)n1 |
| InChI | InChI=1S/C5H5N5S/c1-5(11-4-6-1)2-10-8-3-7-9-10/h1,3-4H,2H2 |
| InChIKey | YIJXAEZIJLZHAK-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.20 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |