C10H8BrNO2S — CID 130572573
4-bromo-7-(oxetan-3-yloxy)thieno[2,3-c]pyridine (PubChem CID 130572573) has the molecular formula C10H8BrNO2S and a molecular weight of 286.15 g/mol. Its IUPAC name is 4-bromo-7-(oxetan-3-yloxy)thieno[2,3-c]pyridine.
| Compound Name | 4-bromo-7-(oxetan-3-yloxy)thieno[2,3-c]pyridine |
|---|---|
| PubChem CID | 130572573 |
| Molecular Formula | C10H8BrNO2S |
| Molecular Weight | 286.15 g/mol |
| Exact Mass | 284.95 |
| IUPAC Name | 4-bromo-7-(oxetan-3-yloxy)thieno[2,3-c]pyridine |
| SMILES | Brc1cnc(OC2COC2)c2sccc12 |
| InChI | InChI=1S/C10H8BrNO2S/c11-8-3-12-10(14-6-4-13-5-6)9-7(8)1-2-15-9/h1-3,6H,4-5H2 |
| InChIKey | HYBRCRMYRINDKW-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.15 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |