C11H9BrN2S — CID 130572496
4-bromo-N-but-2-ynylthieno[2,3-c]pyridin-7-amine (PubChem CID 130572496) has the molecular formula C11H9BrN2S and a molecular weight of 281.18 g/mol. Its IUPAC name is 4-bromo-N-but-2-ynylthieno[2,3-c]pyridin-7-amine.
| Compound Name | 4-bromo-N-but-2-ynylthieno[2,3-c]pyridin-7-amine |
|---|---|
| PubChem CID | 130572496 |
| Molecular Formula | C11H9BrN2S |
| Molecular Weight | 281.18 g/mol |
| Exact Mass | 279.97 |
| IUPAC Name | 4-bromo-N-but-2-ynylthieno[2,3-c]pyridin-7-amine |
| SMILES | CC#CCNc1ncc(Br)c2ccsc12 |
| InChI | InChI=1S/C11H9BrN2S/c1-2-3-5-13-11-10-8(4-6-15-10)9(12)7-14-11/h4,6-7H,5H2,1H3,(H,13,14) |
| InChIKey | RDMQNIVFIQMRBW-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.18 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|