C9H12BrNOS — CID 130583401
4-[5-(bromomethyl)oxolan-2-yl]-2-methyl-1,3-thiazole (PubChem CID 130583401) has the molecular formula C9H12BrNOS and a molecular weight of 262.17 g/mol. Its IUPAC name is 4-[5-(bromomethyl)oxolan-2-yl]-2-methyl-1,3-thiazole.
| Compound Name | 4-[5-(bromomethyl)oxolan-2-yl]-2-methyl-1,3-thiazole |
|---|---|
| PubChem CID | 130583401 |
| Molecular Formula | C9H12BrNOS |
| Molecular Weight | 262.17 g/mol |
| Exact Mass | 260.98 |
| IUPAC Name | 4-[5-(bromomethyl)oxolan-2-yl]-2-methyl-1,3-thiazole |
| SMILES | Cc1nc(C2CCC(CBr)O2)cs1 |
| InChI | InChI=1S/C9H12BrNOS/c1-6-11-8(5-13-6)9-3-2-7(4-10)12-9/h5,7,9H,2-4H2,1H3 |
| InChIKey | PNFPSTYZJSISKO-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.17 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|