C12H23NS — CID 143290404
2,4-dimethyl-1,3-thiazole;ethane;methylcyclobutane (PubChem CID 143290404) has the molecular formula C12H23NS and a molecular weight of 213.39 g/mol. Its IUPAC name is 2,4-dimethyl-1,3-thiazole;ethane;methylcyclobutane.
| Compound Name | 2,4-dimethyl-1,3-thiazole;ethane;methylcyclobutane |
|---|---|
| PubChem CID | 143290404 |
| Molecular Formula | C12H23NS |
| Molecular Weight | 213.39 g/mol |
| Exact Mass | 213.16 |
| IUPAC Name | 2,4-dimethyl-1,3-thiazole;ethane;methylcyclobutane |
| SMILES | CC.CC1CCC1.Cc1csc(C)n1 |
| InChI | InChI=1S/C5H7NS.C5H10.C2H6/c1-4-3-7-5(2)6-4;1-5-3-2-4-5;1-2/h3H,1-2H3;5H,2-4H2,1H3;1-2H3 |
| InChIKey | IILCOXXOJHGPTM-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.39 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |