C11H9NO — CID 130590897
1-(6,7-dihydro-5H-cyclopenta[b]pyridin-2-yl)prop-2-yn-1-one (PubChem CID 130590897) has the molecular formula C11H9NO and a molecular weight of 171.20 g/mol. Its IUPAC name is 1-(6,7-dihydro-5H-cyclopenta[b]pyridin-2-yl)prop-2-yn-1-one.
| Compound Name | 1-(6,7-dihydro-5H-cyclopenta[b]pyridin-2-yl)prop-2-yn-1-one |
|---|---|
| PubChem CID | 130590897 |
| Molecular Formula | C11H9NO |
| Molecular Weight | 171.20 g/mol |
| Exact Mass | 171.07 |
| IUPAC Name | 1-(6,7-dihydro-5H-cyclopenta[b]pyridin-2-yl)prop-2-yn-1-one |
| SMILES | C#CC(=O)c1ccc2c(n1)CCC2 |
| InChI | InChI=1S/C11H9NO/c1-2-11(13)10-7-6-8-4-3-5-9(8)12-10/h1,6-7H,3-5H2 |
| InChIKey | YYHQHCNFXSYRCH-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.20 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|