About 1-(6,7-dihydro-5H-cyclopenta[b]pyridin-2-yl)prop-2-yn-1-one
1-(6,7-dihydro-5H-cyclopenta[b]pyridin-2-yl)prop-2-yn-1-one (PubChem CID 130590897) has the molecular formula C11H9NO
and a molecular weight of 171.20 g/mol. Its IUPAC name is 1-(6,7-dihydro-5H-cyclopenta[b]pyridin-2-yl)prop-2-yn-1-one.
Molecular Properties
| Compound Name | 1-(6,7-dihydro-5H-cyclopenta[b]pyridin-2-yl)prop-2-yn-1-one |
| PubChem CID | 130590897 |
| Molecular Formula | C11H9NO |
| Molecular Weight | 171.20 g/mol |
| Exact Mass | 171.07 |
| IUPAC Name | 1-(6,7-dihydro-5H-cyclopenta[b]pyridin-2-yl)prop-2-yn-1-one |
| SMILES | C#CC(=O)c1ccc2c(n1)CCC2 |
| InChI | InChI=1S/C11H9NO/c1-2-11(13)10-7-6-8-4-3-5-9(8)12-10/h1,6-7H,3-5H2 |
| InChIKey | YYHQHCNFXSYRCH-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.20 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-(6,7-dihydro-5H-cyclopenta[b]pyridin-2-yl)prop-2-yn-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(6,7-dihydro-5H-cyclopenta[b]pyridin-2-yl)prop-2-yn-1-one?
The IUPAC name of 1-(6,7-dihydro-5H-cyclopenta[b]pyridin-2-yl)prop-2-yn-1-one (CID 130590897) is 1-(6,7-dihydro-5H-cyclopenta[b]pyridin-2-yl)prop-2-yn-1-one.
What is the SMILES notation for 1-(6,7-dihydro-5H-cyclopenta[b]pyridin-2-yl)prop-2-yn-1-one?
The canonical SMILES for 1-(6,7-dihydro-5H-cyclopenta[b]pyridin-2-yl)prop-2-yn-1-one is C#CC(=O)c1ccc2c(n1)CCC2.
What is the InChIKey of 1-(6,7-dihydro-5H-cyclopenta[b]pyridin-2-yl)prop-2-yn-1-one?
The InChIKey is YYHQHCNFXSYRCH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9NO/c1-2-11(13)10-7-6-8-4-3-5-9(8)12-10/h1,6-7H,3-5H2.
What are the key properties of 1-(6,7-dihydro-5H-cyclopenta[b]pyridin-2-yl)prop-2-yn-1-one?
1-(6,7-dihydro-5H-cyclopenta[b]pyridin-2-yl)prop-2-yn-1-one has a molecular weight of 171.20 g/mol, XLogP of 1.39, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(6,7-dihydro-5H-cyclopenta[b]pyridin-2-yl)prop-2-yn-1-one is sourced from PubChem (CID 130590897), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).