C9H12N2OS — CID 130591216
2,3-dihydro-1,4-benzoxathiin-2-ylmethylhydrazine (PubChem CID 130591216) has the molecular formula C9H12N2OS and a molecular weight of 196.28 g/mol. Its IUPAC name is 2,3-dihydro-1,4-benzoxathiin-2-ylmethylhydrazine.
| Compound Name | 2,3-dihydro-1,4-benzoxathiin-2-ylmethylhydrazine |
|---|---|
| PubChem CID | 130591216 |
| Molecular Formula | C9H12N2OS |
| Molecular Weight | 196.28 g/mol |
| Exact Mass | 196.07 |
| IUPAC Name | 2,3-dihydro-1,4-benzoxathiin-2-ylmethylhydrazine |
| SMILES | NNCC1CSc2ccccc2O1 |
| InChI | InChI=1S/C9H12N2OS/c10-11-5-7-6-13-9-4-2-1-3-8(9)12-7/h1-4,7,11H,5-6,10H2 |
| InChIKey | WQOFHFKUXOYDMK-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.28 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|