C12H15NO2S — CID 21055364
N-(oxiran-2-ylmethyl)-3,4-dihydro-2H-1,5-benzoxathiepin-3-amine (PubChem CID 21055364) has the molecular formula C12H15NO2S and a molecular weight of 237.32 g/mol. Its IUPAC name is N-(oxiran-2-ylmethyl)-3,4-dihydro-2H-1,5-benzoxathiepin-3-amine.
| Compound Name | N-(oxiran-2-ylmethyl)-3,4-dihydro-2H-1,5-benzoxathiepin-3-amine |
|---|---|
| PubChem CID | 21055364 |
| Molecular Formula | C12H15NO2S |
| Molecular Weight | 237.32 g/mol |
| Exact Mass | 237.08 |
| IUPAC Name | N-(oxiran-2-ylmethyl)-3,4-dihydro-2H-1,5-benzoxathiepin-3-amine |
| SMILES | c1ccc2c(c1)OCC(NCC1CO1)CS2 |
| InChI | InChI=1S/C12H15NO2S/c1-2-4-12-11(3-1)15-6-9(8-16-12)13-5-10-7-14-10/h1-4,9-10,13H,5-8H2 |
| InChIKey | IVRSTRYJKZCBCX-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 33.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.32 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|