C23H27NO7S2 — CID 24895758
(Z)-but-2-enedioic acid;1-[[(3R)-3,4-dihydro-2H-1,5-benzoxathiepin-3-yl]amino]-3-(2-methoxyphenyl)sulfanylpropan-2-ol (PubChem CID 24895758) has the molecular formula C23H27NO7S2 and a molecular weight of 493.60 g/mol. Its IUPAC name is (Z)-but-2-enedioic acid;1-[[(3R)-3,4-dihydro-2H-1,5-benzoxathiepin-3-yl]amino]-3-(2-methoxyphenyl)sulfanylpropan-2-ol.
| Compound Name | (Z)-but-2-enedioic acid;1-[[(3R)-3,4-dihydro-2H-1,5-benzoxathiepin-3-yl]amino]-3-(2-methoxyphenyl)sulfanylpropan-2-ol |
|---|---|
| PubChem CID | 24895758 |
| Molecular Formula | C23H27NO7S2 |
| Molecular Weight | 493.60 g/mol |
| Exact Mass | 493.12 |
| IUPAC Name | (Z)-but-2-enedioic acid;1-[[(3R)-3,4-dihydro-2H-1,5-benzoxathiepin-3-yl]amino]-3-(2-methoxyphenyl)sulfanylpropan-2-ol |
| SMILES | COc1ccccc1SCC(O)CN[C@@H]1COc2ccccc2SC1.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C19H23NO3S2.C4H4O4/c1-22-16-6-2-4-8-18(16)25-13-15(21)10-20-14-11-23-17-7-3-5-9-19(17)24-12-14;5-3(6)1-2-4(7)8/h2-9,14-15,20-21H,10-13H2,1H3;1-2H,(H,5,6)(H,7,8)/b;2-1-/t14-,15?;/m1./s1 |
| InChIKey | BOKLHJFLXMXFAO-XYVADVQMSA-N |
| XLogP | 3.00 |
| TPSA | 125.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.60 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|