C11H11NO2 — CID 130595323
5-hydroxy-2-methyl-N-prop-2-ynylbenzamide (PubChem CID 130595323) has the molecular formula C11H11NO2 and a molecular weight of 189.21 g/mol. Its IUPAC name is 5-hydroxy-2-methyl-N-prop-2-ynylbenzamide.
| Compound Name | 5-hydroxy-2-methyl-N-prop-2-ynylbenzamide |
|---|---|
| PubChem CID | 130595323 |
| Molecular Formula | C11H11NO2 |
| Molecular Weight | 189.21 g/mol |
| Exact Mass | 189.08 |
| IUPAC Name | 5-hydroxy-2-methyl-N-prop-2-ynylbenzamide |
| SMILES | C#CCNC(=O)c1cc(O)ccc1C |
| InChI | InChI=1S/C11H11NO2/c1-3-6-12-11(14)10-7-9(13)5-4-8(10)2/h1,4-5,7,13H,6H2,2H3,(H,12,14) |
| InChIKey | FLIIMPVTCWNCAP-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.21 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|