About 5-(2-amino-1,1-difluoroethyl)-1,2,4-oxadiazole-3-carboxylic acid
5-(2-amino-1,1-difluoroethyl)-1,2,4-oxadiazole-3-carboxylic acid (PubChem CID 130600729) has the molecular formula C5H5F2N3O3
and a molecular weight of 193.11 g/mol. Its IUPAC name is 5-(2-amino-1,1-difluoroethyl)-1,2,4-oxadiazole-3-carboxylic acid.
Analyze 5-(2-amino-1,1-difluoroethyl)-1,2,4-oxadiazole-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2-amino-1,1-difluoroethyl)-1,2,4-oxadiazole-3-carboxylic acid?
The IUPAC name of 5-(2-amino-1,1-difluoroethyl)-1,2,4-oxadiazole-3-carboxylic acid (CID 130600729) is 5-(2-amino-1,1-difluoroethyl)-1,2,4-oxadiazole-3-carboxylic acid.
What is the SMILES notation for 5-(2-amino-1,1-difluoroethyl)-1,2,4-oxadiazole-3-carboxylic acid?
The canonical SMILES for 5-(2-amino-1,1-difluoroethyl)-1,2,4-oxadiazole-3-carboxylic acid is NCC(F)(F)c1nc(C(=O)O)no1.
What is the InChIKey of 5-(2-amino-1,1-difluoroethyl)-1,2,4-oxadiazole-3-carboxylic acid?
The InChIKey is QQQICNKXLRCGJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5F2N3O3/c6-5(7,1-8)4-9-2(3(11)12)10-13-4/h1,8H2,(H,11,12).
What are the key properties of 5-(2-amino-1,1-difluoroethyl)-1,2,4-oxadiazole-3-carboxylic acid?
5-(2-amino-1,1-difluoroethyl)-1,2,4-oxadiazole-3-carboxylic acid has a molecular weight of 193.11 g/mol, XLogP of -0.18, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2-amino-1,1-difluoroethyl)-1,2,4-oxadiazole-3-carboxylic acid is sourced from PubChem (CID 130600729), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).