About 3-amino-2,2-difluoro-N-(1H-pyrazol-4-yl)propanamide
3-amino-2,2-difluoro-N-(1H-pyrazol-4-yl)propanamide (PubChem CID 130600837) has the molecular formula C6H8F2N4O
and a molecular weight of 190.15 g/mol. Its IUPAC name is 3-amino-2,2-difluoro-N-(1H-pyrazol-4-yl)propanamide.
Molecular Properties
| Compound Name | 3-amino-2,2-difluoro-N-(1H-pyrazol-4-yl)propanamide |
| PubChem CID | 130600837 |
| Molecular Formula | C6H8F2N4O |
| Molecular Weight | 190.15 g/mol |
| Exact Mass | 190.07 |
| IUPAC Name | 3-amino-2,2-difluoro-N-(1H-pyrazol-4-yl)propanamide |
| SMILES | NCC(F)(F)C(=O)Nc1cn[nH]c1 |
| InChI | InChI=1S/C6H8F2N4O/c7-6(8,3-9)5(13)12-4-1-10-11-2-4/h1-2H,3,9H2,(H,10,11)(H,12,13) |
| InChIKey | AQRPGNFKKFCGKK-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.15 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-amino-2,2-difluoro-N-(1H-pyrazol-4-yl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-2,2-difluoro-N-(1H-pyrazol-4-yl)propanamide?
The IUPAC name of 3-amino-2,2-difluoro-N-(1H-pyrazol-4-yl)propanamide (CID 130600837) is 3-amino-2,2-difluoro-N-(1H-pyrazol-4-yl)propanamide.
What is the SMILES notation for 3-amino-2,2-difluoro-N-(1H-pyrazol-4-yl)propanamide?
The canonical SMILES for 3-amino-2,2-difluoro-N-(1H-pyrazol-4-yl)propanamide is NCC(F)(F)C(=O)Nc1cn[nH]c1.
What is the InChIKey of 3-amino-2,2-difluoro-N-(1H-pyrazol-4-yl)propanamide?
The InChIKey is AQRPGNFKKFCGKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8F2N4O/c7-6(8,3-9)5(13)12-4-1-10-11-2-4/h1-2H,3,9H2,(H,10,11)(H,12,13).
What are the key properties of 3-amino-2,2-difluoro-N-(1H-pyrazol-4-yl)propanamide?
3-amino-2,2-difluoro-N-(1H-pyrazol-4-yl)propanamide has a molecular weight of 190.15 g/mol, XLogP of -0.06, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-2,2-difluoro-N-(1H-pyrazol-4-yl)propanamide is sourced from PubChem (CID 130600837), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).