About [(2S,4S)-4-fluoro-1-(1,3-thiazol-4-ylmethyl)pyrrolidin-2-yl]methanamine;dihydrochloride
[(2S,4S)-4-fluoro-1-(1,3-thiazol-4-ylmethyl)pyrrolidin-2-yl]methanamine;dihydrochloride (PubChem CID 130608585) has the molecular formula C9H16Cl2FN3S
and a molecular weight of 288.22 g/mol. Its IUPAC name is [(2S,4S)-4-fluoro-1-(1,3-thiazol-4-ylmethyl)pyrrolidin-2-yl]methanamine;dihydrochloride.
Molecular Properties
| Compound Name | [(2S,4S)-4-fluoro-1-(1,3-thiazol-4-ylmethyl)pyrrolidin-2-yl]methanamine;dihydrochloride |
| PubChem CID | 130608585 |
| Molecular Formula | C9H16Cl2FN3S |
| Molecular Weight | 288.22 g/mol |
| Exact Mass | 287.04 |
| IUPAC Name | [(2S,4S)-4-fluoro-1-(1,3-thiazol-4-ylmethyl)pyrrolidin-2-yl]methanamine;dihydrochloride |
| SMILES | Cl.Cl.NC[C@@H]1C[C@H](F)CN1Cc1cscn1 |
| InChI | InChI=1S/C9H14FN3S.2ClH/c10-7-1-9(2-11)13(3-7)4-8-5-14-6-12-8;;/h5-7,9H,1-4,11H2;2*1H/t7-,9-;;/m0../s1 |
| InChIKey | FPHDBBMOJLUCJU-VZIDAPDWSA-N |
| XLogP | 1.86 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.22 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [(2S,4S)-4-fluoro-1-(1,3-thiazol-4-ylmethyl)pyrrolidin-2-yl]methanamine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S,4S)-4-fluoro-1-(1,3-thiazol-4-ylmethyl)pyrrolidin-2-yl]methanamine;dihydrochloride?
The IUPAC name of [(2S,4S)-4-fluoro-1-(1,3-thiazol-4-ylmethyl)pyrrolidin-2-yl]methanamine;dihydrochloride (CID 130608585) is [(2S,4S)-4-fluoro-1-(1,3-thiazol-4-ylmethyl)pyrrolidin-2-yl]methanamine;dihydrochloride.
What is the SMILES notation for [(2S,4S)-4-fluoro-1-(1,3-thiazol-4-ylmethyl)pyrrolidin-2-yl]methanamine;dihydrochloride?
The canonical SMILES for [(2S,4S)-4-fluoro-1-(1,3-thiazol-4-ylmethyl)pyrrolidin-2-yl]methanamine;dihydrochloride is Cl.Cl.NC[C@@H]1C[C@H](F)CN1Cc1cscn1.
What is the InChIKey of [(2S,4S)-4-fluoro-1-(1,3-thiazol-4-ylmethyl)pyrrolidin-2-yl]methanamine;dihydrochloride?
The InChIKey is FPHDBBMOJLUCJU-VZIDAPDWSA-N. The full InChI is InChI=1S/C9H14FN3S.2ClH/c10-7-1-9(2-11)13(3-7)4-8-5-14-6-12-8;;/h5-7,9H,1-4,11H2;2*1H/t7-,9-;;/m0../s1.
What are the key properties of [(2S,4S)-4-fluoro-1-(1,3-thiazol-4-ylmethyl)pyrrolidin-2-yl]methanamine;dihydrochloride?
[(2S,4S)-4-fluoro-1-(1,3-thiazol-4-ylmethyl)pyrrolidin-2-yl]methanamine;dihydrochloride has a molecular weight of 288.22 g/mol, XLogP of 1.86, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S,4S)-4-fluoro-1-(1,3-thiazol-4-ylmethyl)pyrrolidin-2-yl]methanamine;dihydrochloride is sourced from PubChem (CID 130608585), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).