About 2-(oxolan-3-ylmethyl)-1,2-oxazol-3-one
2-(oxolan-3-ylmethyl)-1,2-oxazol-3-one (PubChem CID 130614201) has the molecular formula C8H11NO3
and a molecular weight of 169.18 g/mol. Its IUPAC name is 2-(oxolan-3-ylmethyl)-1,2-oxazol-3-one.
Molecular Properties
| Compound Name | 2-(oxolan-3-ylmethyl)-1,2-oxazol-3-one |
| PubChem CID | 130614201 |
| Molecular Formula | C8H11NO3 |
| Molecular Weight | 169.18 g/mol |
| Exact Mass | 169.07 |
| IUPAC Name | 2-(oxolan-3-ylmethyl)-1,2-oxazol-3-one |
| SMILES | O=c1ccon1CC1CCOC1 |
| InChI | InChI=1S/C8H11NO3/c10-8-2-4-12-9(8)5-7-1-3-11-6-7/h2,4,7H,1,3,5-6H2 |
| InChIKey | KFUQQUIYFXIAOQ-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 44.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.18 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(oxolan-3-ylmethyl)-1,2-oxazol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(oxolan-3-ylmethyl)-1,2-oxazol-3-one?
The IUPAC name of 2-(oxolan-3-ylmethyl)-1,2-oxazol-3-one (CID 130614201) is 2-(oxolan-3-ylmethyl)-1,2-oxazol-3-one.
What is the SMILES notation for 2-(oxolan-3-ylmethyl)-1,2-oxazol-3-one?
The canonical SMILES for 2-(oxolan-3-ylmethyl)-1,2-oxazol-3-one is O=c1ccon1CC1CCOC1.
What is the InChIKey of 2-(oxolan-3-ylmethyl)-1,2-oxazol-3-one?
The InChIKey is KFUQQUIYFXIAOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11NO3/c10-8-2-4-12-9(8)5-7-1-3-11-6-7/h2,4,7H,1,3,5-6H2.
What are the key properties of 2-(oxolan-3-ylmethyl)-1,2-oxazol-3-one?
2-(oxolan-3-ylmethyl)-1,2-oxazol-3-one has a molecular weight of 169.18 g/mol, XLogP of 0.48, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(oxolan-3-ylmethyl)-1,2-oxazol-3-one is sourced from PubChem (CID 130614201), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).