C6H8N4OS — CID 130614589
2-[methyl-[(2-oxo-3H-1,3,4-thiadiazol-5-yl)methyl]amino]acetonitrile (PubChem CID 130614589) has the molecular formula C6H8N4OS and a molecular weight of 184.22 g/mol. Its IUPAC name is 2-[methyl-[(2-oxo-3H-1,3,4-thiadiazol-5-yl)methyl]amino]acetonitrile.
| Compound Name | 2-[methyl-[(2-oxo-3H-1,3,4-thiadiazol-5-yl)methyl]amino]acetonitrile |
|---|---|
| PubChem CID | 130614589 |
| Molecular Formula | C6H8N4OS |
| Molecular Weight | 184.22 g/mol |
| Exact Mass | 184.04 |
| IUPAC Name | 2-[methyl-[(2-oxo-3H-1,3,4-thiadiazol-5-yl)methyl]amino]acetonitrile |
| SMILES | CN(CC#N)Cc1n[nH]c(=O)s1 |
| InChI | InChI=1S/C6H8N4OS/c1-10(3-2-7)4-5-8-9-6(11)12-5/h3-4H2,1H3,(H,9,11) |
| InChIKey | NSMVOYIGLZECRV-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 72.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.22 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|