About 2-[methyl(1,3-thiazol-2-ylmethyl)amino]acetonitrile
2-[methyl(1,3-thiazol-2-ylmethyl)amino]acetonitrile (PubChem CID 79421779) has the molecular formula C7H9N3S
and a molecular weight of 167.24 g/mol. Its IUPAC name is 2-[methyl(1,3-thiazol-2-ylmethyl)amino]acetonitrile.
Molecular Properties
| Compound Name | 2-[methyl(1,3-thiazol-2-ylmethyl)amino]acetonitrile |
| PubChem CID | 79421779 |
| Molecular Formula | C7H9N3S |
| Molecular Weight | 167.24 g/mol |
| Exact Mass | 167.05 |
| IUPAC Name | 2-[methyl(1,3-thiazol-2-ylmethyl)amino]acetonitrile |
| SMILES | CN(CC#N)Cc1nccs1 |
| InChI | InChI=1S/C7H9N3S/c1-10(4-2-8)6-7-9-3-5-11-7/h3,5H,4,6H2,1H3 |
| InChIKey | LXNJIZXLLMJQAW-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 39.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.24 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|
Analyze 2-[methyl(1,3-thiazol-2-ylmethyl)amino]acetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[methyl(1,3-thiazol-2-ylmethyl)amino]acetonitrile?
The IUPAC name of 2-[methyl(1,3-thiazol-2-ylmethyl)amino]acetonitrile (CID 79421779) is 2-[methyl(1,3-thiazol-2-ylmethyl)amino]acetonitrile.
What is the SMILES notation for 2-[methyl(1,3-thiazol-2-ylmethyl)amino]acetonitrile?
The canonical SMILES for 2-[methyl(1,3-thiazol-2-ylmethyl)amino]acetonitrile is CN(CC#N)Cc1nccs1.
What is the InChIKey of 2-[methyl(1,3-thiazol-2-ylmethyl)amino]acetonitrile?
The InChIKey is LXNJIZXLLMJQAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N3S/c1-10(4-2-8)6-7-9-3-5-11-7/h3,5H,4,6H2,1H3.
What are the key properties of 2-[methyl(1,3-thiazol-2-ylmethyl)amino]acetonitrile?
2-[methyl(1,3-thiazol-2-ylmethyl)amino]acetonitrile has a molecular weight of 167.24 g/mol, XLogP of 1.10, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[methyl(1,3-thiazol-2-ylmethyl)amino]acetonitrile is sourced from PubChem (CID 79421779), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).