C9H14N4 — CID 130666817
2-[(1,4-dimethylpyrazol-5-yl)methyl-methylamino]acetonitrile (PubChem CID 130666817) has the molecular formula C9H14N4 and a molecular weight of 178.24 g/mol. Its IUPAC name is 2-[(1,4-dimethylpyrazol-5-yl)methyl-methylamino]acetonitrile.
| Compound Name | 2-[(1,4-dimethylpyrazol-5-yl)methyl-methylamino]acetonitrile |
|---|---|
| PubChem CID | 130666817 |
| Molecular Formula | C9H14N4 |
| Molecular Weight | 178.24 g/mol |
| Exact Mass | 178.12 |
| IUPAC Name | 2-[(1,4-dimethylpyrazol-5-yl)methyl-methylamino]acetonitrile |
| SMILES | Cc1cnn(C)c1CN(C)CC#N |
| InChI | InChI=1S/C9H14N4/c1-8-6-11-13(3)9(8)7-12(2)5-4-10/h6H,5,7H2,1-3H3 |
| InChIKey | KZIBJRICJSYLQU-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 44.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.24 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|