C11H13N3 — CID 130615204
(1R)-1-(1,5-naphthyridin-2-yl)propan-1-amine (PubChem CID 130615204) has the molecular formula C11H13N3 and a molecular weight of 187.25 g/mol. Its IUPAC name is (1R)-1-(1,5-naphthyridin-2-yl)propan-1-amine.
| Compound Name | (1R)-1-(1,5-naphthyridin-2-yl)propan-1-amine |
|---|---|
| PubChem CID | 130615204 |
| Molecular Formula | C11H13N3 |
| Molecular Weight | 187.25 g/mol |
| Exact Mass | 187.11 |
| IUPAC Name | (1R)-1-(1,5-naphthyridin-2-yl)propan-1-amine |
| SMILES | CC[C@@H](N)c1ccc2ncccc2n1 |
| InChI | InChI=1S/C11H13N3/c1-2-8(12)9-5-6-10-11(14-9)4-3-7-13-10/h3-8H,2,12H2,1H3/t8-/m1/s1 |
| InChIKey | JLYBYUITUWTWPN-MRVPVSSYSA-N |
| XLogP | 2.04 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.25 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |