C10H13Cl2N3 — CID 67517766
2-(1,5-naphthyridin-2-yl)ethanamine;dihydrochloride (PubChem CID 67517766) has the molecular formula C10H13Cl2N3 and a molecular weight of 246.14 g/mol. Its IUPAC name is 2-(1,5-naphthyridin-2-yl)ethanamine;dihydrochloride.
| Compound Name | 2-(1,5-naphthyridin-2-yl)ethanamine;dihydrochloride |
|---|---|
| PubChem CID | 67517766 |
| Molecular Formula | C10H13Cl2N3 |
| Molecular Weight | 246.14 g/mol |
| Exact Mass | 245.05 |
| IUPAC Name | 2-(1,5-naphthyridin-2-yl)ethanamine;dihydrochloride |
| SMILES | Cl.Cl.NCCc1ccc2ncccc2n1 |
| InChI | InChI=1S/C10H11N3.2ClH/c11-6-5-8-3-4-9-10(13-8)2-1-7-12-9;;/h1-4,7H,5-6,11H2;2*1H |
| InChIKey | IIHAAXWMBWBDGL-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.14 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |