C23H28N4O3 — CID 13062002
2-[2-[3-[4-(3-methoxyphenyl)piperazin-1-yl]propoxy]phenyl]-5-methyl-1,3,4-oxadiazole (PubChem CID 13062002) has the molecular formula C23H28N4O3 and a molecular weight of 408.50 g/mol. Its IUPAC name is 2-[2-[3-[4-(3-methoxyphenyl)piperazin-1-yl]propoxy]phenyl]-5-methyl-1,3,4-oxadiazole.
| Compound Name | 2-[2-[3-[4-(3-methoxyphenyl)piperazin-1-yl]propoxy]phenyl]-5-methyl-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 13062002 |
| Molecular Formula | C23H28N4O3 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.22 |
| IUPAC Name | 2-[2-[3-[4-(3-methoxyphenyl)piperazin-1-yl]propoxy]phenyl]-5-methyl-1,3,4-oxadiazole |
| SMILES | COc1cccc(N2CCN(CCCOc3ccccc3-c3nnc(C)o3)CC2)c1 |
| InChI | InChI=1S/C23H28N4O3/c1-18-24-25-23(30-18)21-9-3-4-10-22(21)29-16-6-11-26-12-14-27(15-13-26)19-7-5-8-20(17-19)28-2/h3-5,7-10,17H,6,11-16H2,1-2H3 |
| InChIKey | ZTZGUAYDVBWCKG-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 63.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|