C6H10N2O2 — CID 130621020
3-(prop-2-ynoxyamino)propanamide (PubChem CID 130621020) has the molecular formula C6H10N2O2 and a molecular weight of 142.16 g/mol. Its IUPAC name is 3-(prop-2-ynoxyamino)propanamide.
| Compound Name | 3-(prop-2-ynoxyamino)propanamide |
|---|---|
| PubChem CID | 130621020 |
| Molecular Formula | C6H10N2O2 |
| Molecular Weight | 142.16 g/mol |
| Exact Mass | 142.07 |
| IUPAC Name | 3-(prop-2-ynoxyamino)propanamide |
| SMILES | C#CCONCCC(N)=O |
| InChI | InChI=1S/C6H10N2O2/c1-2-5-10-8-4-3-6(7)9/h1,8H,3-5H2,(H2,7,9) |
| InChIKey | BJZGEBONTBCASN-UHFFFAOYSA-N |
| XLogP | -0.98 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.16 |
| LogP ≤ 5 | -0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|