About 4-oxohept-6-ynamide
4-oxohept-6-ynamide (PubChem CID 158101819) has the molecular formula C7H9NO2
and a molecular weight of 139.15 g/mol. Its IUPAC name is 4-oxohept-6-ynamide.
Molecular Properties
| Compound Name | 4-oxohept-6-ynamide |
| PubChem CID | 158101819 |
| Molecular Formula | C7H9NO2 |
| Molecular Weight | 139.15 g/mol |
| Exact Mass | 139.06 |
| IUPAC Name | 4-oxohept-6-ynamide |
| SMILES | C#CCC(=O)CCC(N)=O |
| InChI | InChI=1S/C7H9NO2/c1-2-3-6(9)4-5-7(8)10/h1H,3-5H2,(H2,8,10) |
| InChIKey | FPIWMIIVCPUOFO-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.15 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-oxohept-6-ynamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-oxohept-6-ynamide?
The IUPAC name of 4-oxohept-6-ynamide (CID 158101819) is 4-oxohept-6-ynamide.
What is the SMILES notation for 4-oxohept-6-ynamide?
The canonical SMILES for 4-oxohept-6-ynamide is C#CCC(=O)CCC(N)=O.
What is the InChIKey of 4-oxohept-6-ynamide?
The InChIKey is FPIWMIIVCPUOFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9NO2/c1-2-3-6(9)4-5-7(8)10/h1H,3-5H2,(H2,8,10).
What are the key properties of 4-oxohept-6-ynamide?
4-oxohept-6-ynamide has a molecular weight of 139.15 g/mol, XLogP of -0.16, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-oxohept-6-ynamide is sourced from PubChem (CID 158101819), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).