C13H17F2N3 — CID 130625535
2-benzyl-1-(3,3-difluorocyclopentyl)guanidine (PubChem CID 130625535) has the molecular formula C13H17F2N3 and a molecular weight of 253.30 g/mol. Its IUPAC name is 2-benzyl-1-(3,3-difluorocyclopentyl)guanidine.
| Compound Name | 2-benzyl-1-(3,3-difluorocyclopentyl)guanidine |
|---|---|
| PubChem CID | 130625535 |
| Molecular Formula | C13H17F2N3 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.14 |
| IUPAC Name | 2-benzyl-1-(3,3-difluorocyclopentyl)guanidine |
| SMILES | N/C(=N\Cc1ccccc1)NC1CCC(F)(F)C1 |
| InChI | InChI=1S/C13H17F2N3/c14-13(15)7-6-11(8-13)18-12(16)17-9-10-4-2-1-3-5-10/h1-5,11H,6-9H2,(H3,16,17,18) |
| InChIKey | WPAZGGOXBOTEAV-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|