C10H12INO — CID 130642190
(6S)-6-amino-1-iodo-5,6,7,8-tetrahydronaphthalen-2-ol (PubChem CID 130642190) has the molecular formula C10H12INO and a molecular weight of 289.12 g/mol. Its IUPAC name is (6S)-6-amino-1-iodo-5,6,7,8-tetrahydronaphthalen-2-ol.
| Compound Name | (6S)-6-amino-1-iodo-5,6,7,8-tetrahydronaphthalen-2-ol |
|---|---|
| PubChem CID | 130642190 |
| Molecular Formula | C10H12INO |
| Molecular Weight | 289.12 g/mol |
| Exact Mass | 289.00 |
| IUPAC Name | (6S)-6-amino-1-iodo-5,6,7,8-tetrahydronaphthalen-2-ol |
| SMILES | N[C@H]1CCc2c(ccc(O)c2I)C1 |
| InChI | InChI=1S/C10H12INO/c11-10-8-3-2-7(12)5-6(8)1-4-9(10)13/h1,4,7,13H,2-3,5,12H2/t7-/m0/s1 |
| InChIKey | AIWIGODLXSQEDB-ZETCQYMHSA-N |
| XLogP | 1.81 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.12 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|