C10H13ClN2 — CID 130898043
(2R)-5-chloro-1,2,3,4-tetrahydronaphthalene-2,6-diamine (PubChem CID 130898043) has the molecular formula C10H13ClN2 and a molecular weight of 196.68 g/mol. Its IUPAC name is (2R)-5-chloro-1,2,3,4-tetrahydronaphthalene-2,6-diamine.
| Compound Name | (2R)-5-chloro-1,2,3,4-tetrahydronaphthalene-2,6-diamine |
|---|---|
| PubChem CID | 130898043 |
| Molecular Formula | C10H13ClN2 |
| Molecular Weight | 196.68 g/mol |
| Exact Mass | 196.08 |
| IUPAC Name | (2R)-5-chloro-1,2,3,4-tetrahydronaphthalene-2,6-diamine |
| SMILES | Nc1ccc2c(c1Cl)CC[C@@H](N)C2 |
| InChI | InChI=1S/C10H13ClN2/c11-10-8-3-2-7(12)5-6(8)1-4-9(10)13/h1,4,7H,2-3,5,12-13H2/t7-/m1/s1 |
| InChIKey | KOVPAZJTYMNDAG-SSDOTTSWSA-N |
| XLogP | 1.74 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.68 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|